C13H11F4NO3 — CID 135973410
ethyl (Z)-3-hydroxy-2-(methyliminomethyl)-3-(2,3,5,6-tetrafluorophenyl)prop-2-enoate (PubChem CID 135973410) has the molecular formula C13H11F4NO3 and a molecular weight of 305.23 g/mol. Its IUPAC name is ethyl (Z)-3-hydroxy-2-(methyliminomethyl)-3-(2,3,5,6-tetrafluorophenyl)prop-2-enoate.
| Compound Name | ethyl (Z)-3-hydroxy-2-(methyliminomethyl)-3-(2,3,5,6-tetrafluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 135973410 |
| Molecular Formula | C13H11F4NO3 |
| Molecular Weight | 305.23 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | ethyl (Z)-3-hydroxy-2-(methyliminomethyl)-3-(2,3,5,6-tetrafluorophenyl)prop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/C)=C(\O)c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C13H11F4NO3/c1-3-21-13(20)6(5-18-2)12(19)9-10(16)7(14)4-8(15)11(9)17/h4-5,19H,3H2,1-2H3/b12-6-,18-5+ |
| InChIKey | SRAYYTVWYCIWNK-RFHQQVIFSA-N |
| XLogP | 2.78 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.23 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|