About hexan-3-one
hexan-3-one (PubChem CID 135973484) has the molecular formula C6H11O+
and a molecular weight of 99.15 g/mol. Its IUPAC name is hexan-3-one.
Molecular Properties
| Compound Name | hexan-3-one |
| PubChem CID | 135973484 |
| Molecular Formula | C6H11O+ |
| Molecular Weight | 99.15 g/mol |
| Exact Mass | 99.08 |
| IUPAC Name | hexan-3-one |
| SMILES | [CH2+]CC(=O)CCC |
| InChI | InChI=1S/C6H11O/c1-3-5-6(7)4-2/h2-5H2,1H3/q+1 |
| InChIKey | LNUYKFLZXDRUIB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.15 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze hexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-3-one?
The IUPAC name of hexan-3-one (CID 135973484) is hexan-3-one.
What is the SMILES notation for hexan-3-one?
The canonical SMILES for hexan-3-one is [CH2+]CC(=O)CCC.
What is the InChIKey of hexan-3-one?
The InChIKey is LNUYKFLZXDRUIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11O/c1-3-5-6(7)4-2/h2-5H2,1H3/q+1.
What are the key properties of hexan-3-one?
hexan-3-one has a molecular weight of 99.15 g/mol, XLogP of 1.58, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-3-one is sourced from PubChem (CID 135973484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).