C17H17N2O2+ — CID 135973991
5-hydroxy-6-phenyl-3,4,6,9-tetrahydro-2H-pyrano[3,2-c][1,5]naphthyridin-5-ium (PubChem CID 135973991) has the molecular formula C17H17N2O2+ and a molecular weight of 281.33 g/mol. Its IUPAC name is 5-hydroxy-6-phenyl-3,4,6,9-tetrahydro-2H-pyrano[3,2-c][1,5]naphthyridin-5-ium.
| Compound Name | 5-hydroxy-6-phenyl-3,4,6,9-tetrahydro-2H-pyrano[3,2-c][1,5]naphthyridin-5-ium |
|---|---|
| PubChem CID | 135973991 |
| Molecular Formula | C17H17N2O2+ |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 5-hydroxy-6-phenyl-3,4,6,9-tetrahydro-2H-pyrano[3,2-c][1,5]naphthyridin-5-ium |
| SMILES | O[N+]1=C2CCCN=C2C2=C(C=CCO2)C1c1ccccc1 |
| InChI | InChI=1S/C17H17N2O2/c20-19-14-9-4-10-18-15(14)17-13(8-5-11-21-17)16(19)12-6-2-1-3-7-12/h1-3,5-8,16,20H,4,9-11H2/q+1 |
| InChIKey | PDKNXTODGDXWEJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 44.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|