C49H36N4O13S2 — CID 135974074
2-[4-[2,7-bis(1,3-benzothiazol-2-yl)-3-hydroxy-6-oxoxanthen-9-yl]-2-[2-[2-[bis(carboxymethyl)amino]phenoxy]ethoxy]-N-(carboxymethyl)anilino]acetic acid (PubChem CID 135974074) has the molecular formula C49H36N4O13S2 and a molecular weight of 952.98 g/mol. Its IUPAC name is 2-[4-[2,7-bis(1,3-benzothiazol-2-yl)-3-hydroxy-6-oxoxanthen-9-yl]-2-[2-[2-[bis(carboxymethyl)amino]phenoxy]ethoxy]-N-(carboxymethyl)anilino]acetic acid.
| Compound Name | 2-[4-[2,7-bis(1,3-benzothiazol-2-yl)-3-hydroxy-6-oxoxanthen-9-yl]-2-[2-[2-[bis(carboxymethyl)amino]phenoxy]ethoxy]-N-(carboxymethyl)anilino]acetic acid |
|---|---|
| PubChem CID | 135974074 |
| Molecular Formula | C49H36N4O13S2 |
| Molecular Weight | 952.98 g/mol |
| Exact Mass | 952.17 |
| IUPAC Name | 2-[4-[2,7-bis(1,3-benzothiazol-2-yl)-3-hydroxy-6-oxoxanthen-9-yl]-2-[2-[2-[bis(carboxymethyl)amino]phenoxy]ethoxy]-N-(carboxymethyl)anilino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)c1ccccc1OCCOc1cc(-c2c3cc(-c4nc5ccccc5s4)c(=O)cc-3oc3cc(O)c(-c4nc5ccccc5s4)cc23)ccc1N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C49H36N4O13S2/c54-35-20-38-29(18-27(35)48-50-31-7-1-5-11-41(31)67-48)47(30-19-28(36(55)21-39(30)66-38)49-51-32-8-2-6-12-42(32)68-49)26-13-14-34(53(24-45(60)61)25-46(62)63)40(17-26)65-16-15-64-37-10-4-3-9-33(37)52(22-43(56)57)23-44(58)59/h1-14,17-21,54H,15-16,22-25H2,(H,56,57)(H,58,59)(H,60,61)(H,62,63) |
| InChIKey | LRJJPFDPSKMTDO-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 250.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 952.98 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|