About 2-methylimino-5,5-diphenylimidazolidin-4-one
2-methylimino-5,5-diphenylimidazolidin-4-one (PubChem CID 135974495) has the molecular formula C16H15N3O
and a molecular weight of 265.32 g/mol. Its IUPAC name is 2-methylimino-5,5-diphenylimidazolidin-4-one.
Molecular Properties
| Compound Name | 2-methylimino-5,5-diphenylimidazolidin-4-one |
| PubChem CID | 135974495 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-methylimino-5,5-diphenylimidazolidin-4-one |
| SMILES | C/N=C1\NC(=O)C(c2ccccc2)(c2ccccc2)N1 |
| InChI | InChI=1S/C16H15N3O/c1-17-15-18-14(20)16(19-15,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3,(H2,17,18,19,20) |
| InChIKey | BGAXBVYQJWKXBB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylimino-5,5-diphenylimidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylimino-5,5-diphenylimidazolidin-4-one?
The IUPAC name of 2-methylimino-5,5-diphenylimidazolidin-4-one (CID 135974495) is 2-methylimino-5,5-diphenylimidazolidin-4-one.
What is the SMILES notation for 2-methylimino-5,5-diphenylimidazolidin-4-one?
The canonical SMILES for 2-methylimino-5,5-diphenylimidazolidin-4-one is C/N=C1\NC(=O)C(c2ccccc2)(c2ccccc2)N1.
What is the InChIKey of 2-methylimino-5,5-diphenylimidazolidin-4-one?
The InChIKey is BGAXBVYQJWKXBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O/c1-17-15-18-14(20)16(19-15,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3,(H2,17,18,19,20).
What are the key properties of 2-methylimino-5,5-diphenylimidazolidin-4-one?
2-methylimino-5,5-diphenylimidazolidin-4-one has a molecular weight of 265.32 g/mol, XLogP of 1.64, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylimino-5,5-diphenylimidazolidin-4-one is sourced from PubChem (CID 135974495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).