C17H12F3N3O3S — CID 135974778
2,3,4-trifluoro-N-[3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)phenyl]benzenesulfonamide (PubChem CID 135974778) has the molecular formula C17H12F3N3O3S and a molecular weight of 395.36 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)phenyl]benzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-[3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 135974778 |
| Molecular Formula | C17H12F3N3O3S |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 2,3,4-trifluoro-N-[3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)phenyl]benzenesulfonamide |
| SMILES | Cc1cc(=O)[nH]c(-c2cccc(NS(=O)(=O)c3ccc(F)c(F)c3F)c2)n1 |
| InChI | InChI=1S/C17H12F3N3O3S/c1-9-7-14(24)22-17(21-9)10-3-2-4-11(8-10)23-27(25,26)13-6-5-12(18)15(19)16(13)20/h2-8,23H,1H3,(H,21,22,24) |
| InChIKey | LCUZZEXCNBBVIN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|