C18H14F2N5O2+ — CID 135975180
N-[5-(3,5-difluoro-1-hydroxypyridin-1-ium-4-yl)-6-pyridin-3-ylpyrazin-2-yl]cyclopropanecarboxamide (PubChem CID 135975180) has the molecular formula C18H14F2N5O2+ and a molecular weight of 370.34 g/mol. Its IUPAC name is N-[5-(3,5-difluoro-1-hydroxypyridin-1-ium-4-yl)-6-pyridin-3-ylpyrazin-2-yl]cyclopropanecarboxamide.
| Compound Name | N-[5-(3,5-difluoro-1-hydroxypyridin-1-ium-4-yl)-6-pyridin-3-ylpyrazin-2-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 135975180 |
| Molecular Formula | C18H14F2N5O2+ |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-[5-(3,5-difluoro-1-hydroxypyridin-1-ium-4-yl)-6-pyridin-3-ylpyrazin-2-yl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1cnc(-c2c(F)c[n+](O)cc2F)c(-c2cccnc2)n1)C1CC1 |
| InChI | InChI=1S/C18H13F2N5O2/c19-12-8-25(27)9-13(20)15(12)17-16(11-2-1-5-21-6-11)23-14(7-22-17)24-18(26)10-3-4-10/h1-2,5-10,27H,3-4H2/p+1 |
| InChIKey | OSYPUYFAWSUAIK-UHFFFAOYSA-O |
| XLogP | 2.36 |
| TPSA | 91.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|