C11H13F3N2O — CID 135975224
2-(2,2,2-trifluoroethyl)-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-4-one (PubChem CID 135975224) has the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethyl)-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-4-one.
| Compound Name | 2-(2,2,2-trifluoroethyl)-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135975224 |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 2-(2,2,2-trifluoroethyl)-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CC(F)(F)F)nc2c1CCCCC2 |
| InChI | InChI=1S/C11H13F3N2O/c12-11(13,14)6-9-15-8-5-3-1-2-4-7(8)10(17)16-9/h1-6H2,(H,15,16,17) |
| InChIKey | XRYVBPPBZIZISD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |