C13H10Cl2N2O — CID 135975410
4-cyclopropyl-2-(3,5-dichlorophenyl)-1H-pyrimidin-6-one (PubChem CID 135975410) has the molecular formula C13H10Cl2N2O and a molecular weight of 281.14 g/mol. Its IUPAC name is 4-cyclopropyl-2-(3,5-dichlorophenyl)-1H-pyrimidin-6-one.
| Compound Name | 4-cyclopropyl-2-(3,5-dichlorophenyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135975410 |
| Molecular Formula | C13H10Cl2N2O |
| Molecular Weight | 281.14 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | 4-cyclopropyl-2-(3,5-dichlorophenyl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(C2CC2)nc(-c2cc(Cl)cc(Cl)c2)[nH]1 |
| InChI | InChI=1S/C13H10Cl2N2O/c14-9-3-8(4-10(15)5-9)13-16-11(7-1-2-7)6-12(18)17-13/h3-7H,1-2H2,(H,16,17,18) |
| InChIKey | WYHAURADJAABRO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.14 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |