C28H20N2O2SZn — CID 135975844
2-(1,3-benzothiazol-2-yl)phenol;2-isoquinolin-1-ylphenol;zinc (PubChem CID 135975844) has the molecular formula C28H20N2O2SZn and a molecular weight of 513.94 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)phenol;2-isoquinolin-1-ylphenol;zinc.
| Compound Name | 2-(1,3-benzothiazol-2-yl)phenol;2-isoquinolin-1-ylphenol;zinc |
|---|---|
| PubChem CID | 135975844 |
| Molecular Formula | C28H20N2O2SZn |
| Molecular Weight | 513.94 g/mol |
| Exact Mass | 512.05 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)phenol;2-isoquinolin-1-ylphenol;zinc |
| SMILES | Oc1ccccc1-c1nc2ccccc2s1.Oc1ccccc1-c1nccc2ccccc12.[Zn] |
| InChI | InChI=1S/C15H11NO.C13H9NOS.Zn/c17-14-8-4-3-7-13(14)15-12-6-2-1-5-11(12)9-10-16-15;15-11-7-3-1-5-9(11)13-14-10-6-2-4-8-12(10)16-13;/h1-10,17H;1-8,15H; |
| InChIKey | BPMNXQDCYNOFLY-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.94 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|