About 5-(3,4-dimethoxyphenyl)-4-(pyridin-3-yldiazenyl)-1,2-dihydropyrazol-3-one
5-(3,4-dimethoxyphenyl)-4-(pyridin-3-yldiazenyl)-1,2-dihydropyrazol-3-one (PubChem CID 135976655) has the molecular formula C16H15N5O3
and a molecular weight of 325.33 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-4-(pyridin-3-yldiazenyl)-1,2-dihydropyrazol-3-one.
Molecular Properties
| Compound Name | 5-(3,4-dimethoxyphenyl)-4-(pyridin-3-yldiazenyl)-1,2-dihydropyrazol-3-one |
| PubChem CID | 135976655 |
| Molecular Formula | C16H15N5O3 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-4-(pyridin-3-yldiazenyl)-1,2-dihydropyrazol-3-one |
| SMILES | COc1ccc(-c2[nH][nH]c(=O)c2/N=N/c2cccnc2)cc1OC |
| InChI | InChI=1S/C16H15N5O3/c1-23-12-6-5-10(8-13(12)24-2)14-15(16(22)21-19-14)20-18-11-4-3-7-17-9-11/h3-9H,1-2H3,(H2,19,21,22)/b20-18+ |
| InChIKey | DEAHSMVENSTORV-CZIZESTLSA-N |
| XLogP | 3.20 |
| TPSA | 104.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,4-dimethoxyphenyl)-4-(pyridin-3-yldiazenyl)-1,2-dihydropyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dimethoxyphenyl)-4-(pyridin-3-yldiazenyl)-1,2-dihydropyrazol-3-one?
The IUPAC name of 5-(3,4-dimethoxyphenyl)-4-(pyridin-3-yldiazenyl)-1,2-dihydropyrazol-3-one (CID 135976655) is 5-(3,4-dimethoxyphenyl)-4-(pyridin-3-yldiazenyl)-1,2-dihydropyrazol-3-one.
What is the SMILES notation for 5-(3,4-dimethoxyphenyl)-4-(pyridin-3-yldiazenyl)-1,2-dihydropyrazol-3-one?
The canonical SMILES for 5-(3,4-dimethoxyphenyl)-4-(pyridin-3-yldiazenyl)-1,2-dihydropyrazol-3-one is COc1ccc(-c2[nH][nH]c(=O)c2/N=N/c2cccnc2)cc1OC.
What is the InChIKey of 5-(3,4-dimethoxyphenyl)-4-(pyridin-3-yldiazenyl)-1,2-dihydropyrazol-3-one?
The InChIKey is DEAHSMVENSTORV-CZIZESTLSA-N. The full InChI is InChI=1S/C16H15N5O3/c1-23-12-6-5-10(8-13(12)24-2)14-15(16(22)21-19-14)20-18-11-4-3-7-17-9-11/h3-9H,1-2H3,(H2,19,21,22)/b20-18+.
What are the key properties of 5-(3,4-dimethoxyphenyl)-4-(pyridin-3-yldiazenyl)-1,2-dihydropyrazol-3-one?
5-(3,4-dimethoxyphenyl)-4-(pyridin-3-yldiazenyl)-1,2-dihydropyrazol-3-one has a molecular weight of 325.33 g/mol, XLogP of 3.20, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dimethoxyphenyl)-4-(pyridin-3-yldiazenyl)-1,2-dihydropyrazol-3-one is sourced from PubChem (CID 135976655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).