C23H41N7O5 — CID 135977428
[(1R,2S)-1-[(6R)-2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pyrido[2,3-d]pyrimidin-6-yl]-1-[(2S)-2,6-diaminohexanoyl]oxypropan-2-yl] (2S)-2-aminoheptanoate (PubChem CID 135977428) has the molecular formula C23H41N7O5 and a molecular weight of 495.63 g/mol. Its IUPAC name is [(1R,2S)-1-[(6R)-2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pyrido[2,3-d]pyrimidin-6-yl]-1-[(2S)-2,6-diaminohexanoyl]oxypropan-2-yl] (2S)-2-aminoheptanoate.
| Compound Name | [(1R,2S)-1-[(6R)-2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pyrido[2,3-d]pyrimidin-6-yl]-1-[(2S)-2,6-diaminohexanoyl]oxypropan-2-yl] (2S)-2-aminoheptanoate |
|---|---|
| PubChem CID | 135977428 |
| Molecular Formula | C23H41N7O5 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.32 |
| IUPAC Name | [(1R,2S)-1-[(6R)-2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pyrido[2,3-d]pyrimidin-6-yl]-1-[(2S)-2,6-diaminohexanoyl]oxypropan-2-yl] (2S)-2-aminoheptanoate |
| SMILES | CCCCC[C@H](N)C(=O)O[C@@H](C)[C@H](OC(=O)[C@@H](N)CCCCN)[C@H]1CNc2nc(N)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C23H41N7O5/c1-3-4-5-8-16(25)21(32)34-13(2)18(35-22(33)17(26)9-6-7-10-24)14-11-15-19(28-12-14)29-23(27)30-20(15)31/h13-14,16-18H,3-12,24-26H2,1-2H3,(H4,27,28,29,30,31)/t13-,14+,16-,17-,18-/m0/s1 |
| InChIKey | RBZGUYYHYKNQBP-YFUQURRKSA-N |
| XLogP | 0.14 |
| TPSA | 214.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|