About [2-(6-iodo-4-oxo-3H-quinazolin-2-yl)phenyl] methyl hydrogen phosphate
[2-(6-iodo-4-oxo-3H-quinazolin-2-yl)phenyl] methyl hydrogen phosphate (PubChem CID 135978113) has the molecular formula C15H12IN2O5P
and a molecular weight of 458.15 g/mol. Its IUPAC name is [2-(6-iodo-4-oxo-3H-quinazolin-2-yl)phenyl] methyl hydrogen phosphate.
Molecular Properties
| Compound Name | [2-(6-iodo-4-oxo-3H-quinazolin-2-yl)phenyl] methyl hydrogen phosphate |
| PubChem CID | 135978113 |
| Molecular Formula | C15H12IN2O5P |
| Molecular Weight | 458.15 g/mol |
| Exact Mass | 457.95 |
| IUPAC Name | [2-(6-iodo-4-oxo-3H-quinazolin-2-yl)phenyl] methyl hydrogen phosphate |
| SMILES | COP(=O)(O)Oc1ccccc1-c1nc2ccc(I)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H12IN2O5P/c1-22-24(20,21)23-13-5-3-2-4-10(13)14-17-12-7-6-9(16)8-11(12)15(19)18-14/h2-8H,1H3,(H,20,21)(H,17,18,19) |
| InChIKey | DIUZTHOJNIDFBT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.15 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-(6-iodo-4-oxo-3H-quinazolin-2-yl)phenyl] methyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(6-iodo-4-oxo-3H-quinazolin-2-yl)phenyl] methyl hydrogen phosphate?
The IUPAC name of [2-(6-iodo-4-oxo-3H-quinazolin-2-yl)phenyl] methyl hydrogen phosphate (CID 135978113) is [2-(6-iodo-4-oxo-3H-quinazolin-2-yl)phenyl] methyl hydrogen phosphate.
What is the SMILES notation for [2-(6-iodo-4-oxo-3H-quinazolin-2-yl)phenyl] methyl hydrogen phosphate?
The canonical SMILES for [2-(6-iodo-4-oxo-3H-quinazolin-2-yl)phenyl] methyl hydrogen phosphate is COP(=O)(O)Oc1ccccc1-c1nc2ccc(I)cc2c(=O)[nH]1.
What is the InChIKey of [2-(6-iodo-4-oxo-3H-quinazolin-2-yl)phenyl] methyl hydrogen phosphate?
The InChIKey is DIUZTHOJNIDFBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12IN2O5P/c1-22-24(20,21)23-13-5-3-2-4-10(13)14-17-12-7-6-9(16)8-11(12)15(19)18-14/h2-8H,1H3,(H,20,21)(H,17,18,19).
What are the key properties of [2-(6-iodo-4-oxo-3H-quinazolin-2-yl)phenyl] methyl hydrogen phosphate?
[2-(6-iodo-4-oxo-3H-quinazolin-2-yl)phenyl] methyl hydrogen phosphate has a molecular weight of 458.15 g/mol, XLogP of 3.32, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(6-iodo-4-oxo-3H-quinazolin-2-yl)phenyl] methyl hydrogen phosphate is sourced from PubChem (CID 135978113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).