About 5-bromo-2-(5-iodo-1,3,4-thiadiazol-2-yl)phenol
5-bromo-2-(5-iodo-1,3,4-thiadiazol-2-yl)phenol (PubChem CID 135978598) has the molecular formula C8H4BrIN2OS
and a molecular weight of 383.01 g/mol. Its IUPAC name is 5-bromo-2-(5-iodo-1,3,4-thiadiazol-2-yl)phenol.
Molecular Properties
| Compound Name | 5-bromo-2-(5-iodo-1,3,4-thiadiazol-2-yl)phenol |
| PubChem CID | 135978598 |
| Molecular Formula | C8H4BrIN2OS |
| Molecular Weight | 383.01 g/mol |
| Exact Mass | 381.83 |
| IUPAC Name | 5-bromo-2-(5-iodo-1,3,4-thiadiazol-2-yl)phenol |
| SMILES | Oc1cc(Br)ccc1-c1nnc(I)s1 |
| InChI | InChI=1S/C8H4BrIN2OS/c9-4-1-2-5(6(13)3-4)7-11-12-8(10)14-7/h1-3,13H |
| InChIKey | QULBJLBPGREIDP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.01 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-(5-iodo-1,3,4-thiadiazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(5-iodo-1,3,4-thiadiazol-2-yl)phenol?
The IUPAC name of 5-bromo-2-(5-iodo-1,3,4-thiadiazol-2-yl)phenol (CID 135978598) is 5-bromo-2-(5-iodo-1,3,4-thiadiazol-2-yl)phenol.
What is the SMILES notation for 5-bromo-2-(5-iodo-1,3,4-thiadiazol-2-yl)phenol?
The canonical SMILES for 5-bromo-2-(5-iodo-1,3,4-thiadiazol-2-yl)phenol is Oc1cc(Br)ccc1-c1nnc(I)s1.
What is the InChIKey of 5-bromo-2-(5-iodo-1,3,4-thiadiazol-2-yl)phenol?
The InChIKey is QULBJLBPGREIDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4BrIN2OS/c9-4-1-2-5(6(13)3-4)7-11-12-8(10)14-7/h1-3,13H.
What are the key properties of 5-bromo-2-(5-iodo-1,3,4-thiadiazol-2-yl)phenol?
5-bromo-2-(5-iodo-1,3,4-thiadiazol-2-yl)phenol has a molecular weight of 383.01 g/mol, XLogP of 3.28, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(5-iodo-1,3,4-thiadiazol-2-yl)phenol is sourced from PubChem (CID 135978598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).