About 4-[4-(ethylamino)-5,6-dimethylpyrimidin-2-yl]-2,6-dimethylphenol
4-[4-(ethylamino)-5,6-dimethylpyrimidin-2-yl]-2,6-dimethylphenol (PubChem CID 135978666) has the molecular formula C16H21N3O
and a molecular weight of 271.36 g/mol. Its IUPAC name is 4-[4-(ethylamino)-5,6-dimethylpyrimidin-2-yl]-2,6-dimethylphenol.
Molecular Properties
| Compound Name | 4-[4-(ethylamino)-5,6-dimethylpyrimidin-2-yl]-2,6-dimethylphenol |
| PubChem CID | 135978666 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 4-[4-(ethylamino)-5,6-dimethylpyrimidin-2-yl]-2,6-dimethylphenol |
| SMILES | CCNc1nc(-c2cc(C)c(O)c(C)c2)nc(C)c1C |
| InChI | InChI=1S/C16H21N3O/c1-6-17-15-11(4)12(5)18-16(19-15)13-7-9(2)14(20)10(3)8-13/h7-8,20H,6H2,1-5H3,(H,17,18,19) |
| InChIKey | AEBNSOCSUIRHQB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-(ethylamino)-5,6-dimethylpyrimidin-2-yl]-2,6-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(ethylamino)-5,6-dimethylpyrimidin-2-yl]-2,6-dimethylphenol?
The IUPAC name of 4-[4-(ethylamino)-5,6-dimethylpyrimidin-2-yl]-2,6-dimethylphenol (CID 135978666) is 4-[4-(ethylamino)-5,6-dimethylpyrimidin-2-yl]-2,6-dimethylphenol.
What is the SMILES notation for 4-[4-(ethylamino)-5,6-dimethylpyrimidin-2-yl]-2,6-dimethylphenol?
The canonical SMILES for 4-[4-(ethylamino)-5,6-dimethylpyrimidin-2-yl]-2,6-dimethylphenol is CCNc1nc(-c2cc(C)c(O)c(C)c2)nc(C)c1C.
What is the InChIKey of 4-[4-(ethylamino)-5,6-dimethylpyrimidin-2-yl]-2,6-dimethylphenol?
The InChIKey is AEBNSOCSUIRHQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O/c1-6-17-15-11(4)12(5)18-16(19-15)13-7-9(2)14(20)10(3)8-13/h7-8,20H,6H2,1-5H3,(H,17,18,19).
What are the key properties of 4-[4-(ethylamino)-5,6-dimethylpyrimidin-2-yl]-2,6-dimethylphenol?
4-[4-(ethylamino)-5,6-dimethylpyrimidin-2-yl]-2,6-dimethylphenol has a molecular weight of 271.36 g/mol, XLogP of 3.51, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(ethylamino)-5,6-dimethylpyrimidin-2-yl]-2,6-dimethylphenol is sourced from PubChem (CID 135978666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).