About 2,4-ditert-butyl-6-[8-(2,6-dimethylanilino)quinolin-2-yl]phenol
2,4-ditert-butyl-6-[8-(2,6-dimethylanilino)quinolin-2-yl]phenol (PubChem CID 135979345) has the molecular formula C31H36N2O
and a molecular weight of 452.64 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[8-(2,6-dimethylanilino)quinolin-2-yl]phenol.
Molecular Properties
| Compound Name | 2,4-ditert-butyl-6-[8-(2,6-dimethylanilino)quinolin-2-yl]phenol |
| PubChem CID | 135979345 |
| Molecular Formula | C31H36N2O |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | 2,4-ditert-butyl-6-[8-(2,6-dimethylanilino)quinolin-2-yl]phenol |
| SMILES | Cc1cccc(C)c1Nc1cccc2ccc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3O)nc12 |
| InChI | InChI=1S/C31H36N2O/c1-19-11-9-12-20(2)27(19)33-26-14-10-13-21-15-16-25(32-28(21)26)23-17-22(30(3,4)5)18-24(29(23)34)31(6,7)8/h9-18,33-34H,1-8H3 |
| InChIKey | PVWRGDSYTAYROS-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-ditert-butyl-6-[8-(2,6-dimethylanilino)quinolin-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-ditert-butyl-6-[8-(2,6-dimethylanilino)quinolin-2-yl]phenol?
The IUPAC name of 2,4-ditert-butyl-6-[8-(2,6-dimethylanilino)quinolin-2-yl]phenol (CID 135979345) is 2,4-ditert-butyl-6-[8-(2,6-dimethylanilino)quinolin-2-yl]phenol.
What is the SMILES notation for 2,4-ditert-butyl-6-[8-(2,6-dimethylanilino)quinolin-2-yl]phenol?
The canonical SMILES for 2,4-ditert-butyl-6-[8-(2,6-dimethylanilino)quinolin-2-yl]phenol is Cc1cccc(C)c1Nc1cccc2ccc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3O)nc12.
What is the InChIKey of 2,4-ditert-butyl-6-[8-(2,6-dimethylanilino)quinolin-2-yl]phenol?
The InChIKey is PVWRGDSYTAYROS-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H36N2O/c1-19-11-9-12-20(2)27(19)33-26-14-10-13-21-15-16-25(32-28(21)26)23-17-22(30(3,4)5)18-24(29(23)34)31(6,7)8/h9-18,33-34H,1-8H3.
What are the key properties of 2,4-ditert-butyl-6-[8-(2,6-dimethylanilino)quinolin-2-yl]phenol?
2,4-ditert-butyl-6-[8-(2,6-dimethylanilino)quinolin-2-yl]phenol has a molecular weight of 452.64 g/mol, XLogP of 8.56, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-ditert-butyl-6-[8-(2,6-dimethylanilino)quinolin-2-yl]phenol is sourced from PubChem (CID 135979345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).