About CID 135979384
CID 135979384 (PubChem CID 135979384) has the molecular formula C32H32N15O4
and a molecular weight of 690.71 g/mol.
Molecular Properties
| Compound Name | CID 135979384 |
| PubChem CID | 135979384 |
| Molecular Formula | C32H32N15O4 |
| Molecular Weight | 690.71 g/mol |
| Exact Mass | 690.28 |
| IUPAC Name | — |
| SMILES | [CH2]c1c(/N=N/c2c(C(=O)OC)cnn2C)c(CCCc2nn(-c3ccccn3)c(N)c2/N=N/c2c(C(=O)CO)cnn2C)nn1-c1ccccn1 |
| InChI | InChI=1S/C32H32N15O4/c1-19-27(38-41-31-21(32(50)51-4)17-37-45(31)3)22(42-46(19)25-12-5-7-14-34-25)10-9-11-23-28(29(33)47(43-23)26-13-6-8-15-35-26)39-40-30-20(24(49)18-48)16-36-44(30)2/h5-8,12-17,48H,1,9-11,18,33H2,2-4H3/b40-39+,41-38+ |
| InChIKey | GTALMJALMARSEQ-SQYMYULGSA-N |
| XLogP | 4.05 |
| TPSA | 236.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 690.71 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 19 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze CID 135979384 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135979384?
The IUPAC name of CID 135979384 (CID 135979384) is not available.
What is the SMILES notation for CID 135979384?
The canonical SMILES for CID 135979384 is [CH2]c1c(/N=N/c2c(C(=O)OC)cnn2C)c(CCCc2nn(-c3ccccn3)c(N)c2/N=N/c2c(C(=O)CO)cnn2C)nn1-c1ccccn1.
What is the InChIKey of CID 135979384?
The InChIKey is GTALMJALMARSEQ-SQYMYULGSA-N. The full InChI is InChI=1S/C32H32N15O4/c1-19-27(38-41-31-21(32(50)51-4)17-37-45(31)3)22(42-46(19)25-12-5-7-14-34-25)10-9-11-23-28(29(33)47(43-23)26-13-6-8-15-35-26)39-40-30-20(24(49)18-48)16-36-44(30)2/h5-8,12-17,48H,1,9-11,18,33H2,2-4H3/b40-39+,41-38+.
What are the key properties of CID 135979384?
CID 135979384 has a molecular weight of 690.71 g/mol, XLogP of 4.05, 13 rotatable bonds, 2 hydrogen bond donors, and 19 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135979384 is sourced from PubChem (CID 135979384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).