About 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidine
4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidine (PubChem CID 135979561) has the molecular formula C5H6N4
and a molecular weight of 122.13 g/mol. Its IUPAC name is 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidine |
| PubChem CID | 135979561 |
| Molecular Formula | C5H6N4 |
| Molecular Weight | 122.13 g/mol |
| Exact Mass | 122.06 |
| IUPAC Name | 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidine |
| SMILES | C1=NCc2cn[nH]c2N1 |
| InChI | InChI=1S/C5H6N4/c1-4-2-8-9-5(4)7-3-6-1/h2-3H,1H2,(H2,6,7,8,9) |
| InChIKey | HCKWIDXZRSTLMG-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.13 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidine?
The IUPAC name of 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidine (CID 135979561) is 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidine.
What is the SMILES notation for 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidine?
The canonical SMILES for 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidine is C1=NCc2cn[nH]c2N1.
What is the InChIKey of 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidine?
The InChIKey is HCKWIDXZRSTLMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N4/c1-4-2-8-9-5(4)7-3-6-1/h2-3H,1H2,(H2,6,7,8,9).
What are the key properties of 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidine?
4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidine has a molecular weight of 122.13 g/mol, XLogP of 0.36, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidine is sourced from PubChem (CID 135979561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).