C18H18N8O — CID 135979614
N-(4-morpholin-4-ylphenyl)-5-(1H-pyrazol-4-yl)-[1,2,4]triazolo[1,5-a]pyrazin-8-amine (PubChem CID 135979614) has the molecular formula C18H18N8O and a molecular weight of 362.40 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-5-(1H-pyrazol-4-yl)-[1,2,4]triazolo[1,5-a]pyrazin-8-amine.
| Compound Name | N-(4-morpholin-4-ylphenyl)-5-(1H-pyrazol-4-yl)-[1,2,4]triazolo[1,5-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 135979614 |
| Molecular Formula | C18H18N8O |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-5-(1H-pyrazol-4-yl)-[1,2,4]triazolo[1,5-a]pyrazin-8-amine |
| SMILES | c1nc2c(Nc3ccc(N4CCOCC4)cc3)ncc(-c3cn[nH]c3)n2n1 |
| InChI | InChI=1S/C18H18N8O/c1-3-15(25-5-7-27-8-6-25)4-2-14(1)24-17-18-20-12-23-26(18)16(11-19-17)13-9-21-22-10-13/h1-4,9-12H,5-8H2,(H,19,24)(H,21,22) |
| InChIKey | WSPYBPVYCFYIRM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|