C36H40N4O4 — CID 135979808
methyl (3E)-3-[(17S,18S)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-18-(3-oxobutyl)-18,24-dihydro-17H-porphyrin-2-ylidene]-3-hydroxypropanoate (PubChem CID 135979808) has the molecular formula C36H40N4O4 and a molecular weight of 592.74 g/mol. Its IUPAC name is methyl (3E)-3-[(17S,18S)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-18-(3-oxobutyl)-18,24-dihydro-17H-porphyrin-2-ylidene]-3-hydroxypropanoate.
| Compound Name | methyl (3E)-3-[(17S,18S)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-18-(3-oxobutyl)-18,24-dihydro-17H-porphyrin-2-ylidene]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 135979808 |
| Molecular Formula | C36H40N4O4 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.30 |
| IUPAC Name | methyl (3E)-3-[(17S,18S)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-18-(3-oxobutyl)-18,24-dihydro-17H-porphyrin-2-ylidene]-3-hydroxypropanoate |
| SMILES | C=CC1=C(C)C2=N/C1=C\C1=N/C(=C\C3=C(C)/C(=C(\O)CC(=O)OC)C(=N3)/C=C3\N/C(=C\2)[C@@H](C)[C@@H]3CCC(C)=O)C(CC)=C1C |
| InChI | InChI=1S/C36H40N4O4/c1-9-23-19(4)26-13-27-21(6)25(12-11-18(3)41)32(39-27)16-33-36(34(42)17-35(43)44-8)22(7)29(40-33)15-31-24(10-2)20(5)28(38-31)14-30(23)37-26/h9,13-16,21,25,39,42H,1,10-12,17H2,2-8H3/b27-13-,30-14-,31-15-,32-16-,36-34+/t21-,25-/m0/s1 |
| InChIKey | DOEPVTLVZDIOLX-LPCJLZBGSA-N |
| XLogP | 7.00 |
| TPSA | 112.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|