C23H16ClN2O4S- — CID 135980728
2-chloro-5-[5-[(Z)-[2-(3,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 135980728) has the molecular formula C23H16ClN2O4S- and a molecular weight of 451.91 g/mol. Its IUPAC name is 2-chloro-5-[5-[(Z)-[2-(3,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | 2-chloro-5-[5-[(Z)-[2-(3,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 135980728 |
| Molecular Formula | C23H16ClN2O4S- |
| Molecular Weight | 451.91 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | 2-chloro-5-[5-[(Z)-[2-(3,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | Cc1ccc(/N=C2\NC(=O)/C(=C/c3ccc(-c4ccc(Cl)c(C(=O)[O-])c4)o3)S2)cc1C |
| InChI | InChI=1S/C23H17ClN2O4S/c1-12-3-5-15(9-13(12)2)25-23-26-21(27)20(31-23)11-16-6-8-19(30-16)14-4-7-18(24)17(10-14)22(28)29/h3-11H,1-2H3,(H,28,29)(H,25,26,27)/p-1/b20-11- |
| InChIKey | JGYDCAIHJGRPAB-JAIQZWGSSA-M |
| XLogP | 4.47 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.91 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|