C22H17F2N7O2 — CID 135981228
(NE)-N-[1-[3-[[3-(3,5-dimethyl-1,2-oxazol-4-yl)-5,7-difluoroquinolin-6-yl]methyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]ethylidene]hydroxylamine (PubChem CID 135981228) has the molecular formula C22H17F2N7O2 and a molecular weight of 449.42 g/mol. Its IUPAC name is (NE)-N-[1-[3-[[3-(3,5-dimethyl-1,2-oxazol-4-yl)-5,7-difluoroquinolin-6-yl]methyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[3-[[3-(3,5-dimethyl-1,2-oxazol-4-yl)-5,7-difluoroquinolin-6-yl]methyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 135981228 |
| Molecular Formula | C22H17F2N7O2 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | (NE)-N-[1-[3-[[3-(3,5-dimethyl-1,2-oxazol-4-yl)-5,7-difluoroquinolin-6-yl]methyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]ethylidene]hydroxylamine |
| SMILES | C/C(=N\O)c1ccc2nnc(Cc3c(F)cc4ncc(-c5c(C)noc5C)cc4c3F)n2n1 |
| InChI | InChI=1S/C22H17F2N7O2/c1-10(29-32)17-4-5-19-26-27-20(31(19)28-17)7-14-16(23)8-18-15(22(14)24)6-13(9-25-18)21-11(2)30-33-12(21)3/h4-6,8-9,32H,7H2,1-3H3/b29-10+ |
| InChIKey | RYXSEOGGYQGZMF-VYVUJPJFSA-N |
| XLogP | 4.01 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|