About 3-diazo-1-[(1S,3S)-1-methyl-2-methylidene-3-prop-1-en-2-ylcyclopentyl]butan-2-one
3-diazo-1-[(1S,3S)-1-methyl-2-methylidene-3-prop-1-en-2-ylcyclopentyl]butan-2-one (PubChem CID 135981781) has the molecular formula C14H20N2O
and a molecular weight of 232.33 g/mol. Its IUPAC name is 3-diazo-1-[(1S,3S)-1-methyl-2-methylidene-3-prop-1-en-2-ylcyclopentyl]butan-2-one.
Molecular Properties
| Compound Name | 3-diazo-1-[(1S,3S)-1-methyl-2-methylidene-3-prop-1-en-2-ylcyclopentyl]butan-2-one |
| PubChem CID | 135981781 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 3-diazo-1-[(1S,3S)-1-methyl-2-methylidene-3-prop-1-en-2-ylcyclopentyl]butan-2-one |
| SMILES | C=C(C)[C@@H]1CC[C@@](C)(CC(=O)C(C)=[N+]=[N-])C1=C |
| InChI | InChI=1S/C14H20N2O/c1-9(2)12-6-7-14(5,10(12)3)8-13(17)11(4)16-15/h12H,1,3,6-8H2,2,4-5H3/t12-,14-/m0/s1 |
| InChIKey | LWUYPGPNJLWFGU-JSGCOSHPSA-N |
| XLogP | 3.18 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-diazo-1-[(1S,3S)-1-methyl-2-methylidene-3-prop-1-en-2-ylcyclopentyl]butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diazo-1-[(1S,3S)-1-methyl-2-methylidene-3-prop-1-en-2-ylcyclopentyl]butan-2-one?
The IUPAC name of 3-diazo-1-[(1S,3S)-1-methyl-2-methylidene-3-prop-1-en-2-ylcyclopentyl]butan-2-one (CID 135981781) is 3-diazo-1-[(1S,3S)-1-methyl-2-methylidene-3-prop-1-en-2-ylcyclopentyl]butan-2-one.
What is the SMILES notation for 3-diazo-1-[(1S,3S)-1-methyl-2-methylidene-3-prop-1-en-2-ylcyclopentyl]butan-2-one?
The canonical SMILES for 3-diazo-1-[(1S,3S)-1-methyl-2-methylidene-3-prop-1-en-2-ylcyclopentyl]butan-2-one is C=C(C)[C@@H]1CC[C@@](C)(CC(=O)C(C)=[N+]=[N-])C1=C.
What is the InChIKey of 3-diazo-1-[(1S,3S)-1-methyl-2-methylidene-3-prop-1-en-2-ylcyclopentyl]butan-2-one?
The InChIKey is LWUYPGPNJLWFGU-JSGCOSHPSA-N. The full InChI is InChI=1S/C14H20N2O/c1-9(2)12-6-7-14(5,10(12)3)8-13(17)11(4)16-15/h12H,1,3,6-8H2,2,4-5H3/t12-,14-/m0/s1.
What are the key properties of 3-diazo-1-[(1S,3S)-1-methyl-2-methylidene-3-prop-1-en-2-ylcyclopentyl]butan-2-one?
3-diazo-1-[(1S,3S)-1-methyl-2-methylidene-3-prop-1-en-2-ylcyclopentyl]butan-2-one has a molecular weight of 232.33 g/mol, XLogP of 3.18, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diazo-1-[(1S,3S)-1-methyl-2-methylidene-3-prop-1-en-2-ylcyclopentyl]butan-2-one is sourced from PubChem (CID 135981781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).