About N-[3-chloro-2-hydroxy-5-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenyl]acetamide
N-[3-chloro-2-hydroxy-5-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenyl]acetamide (PubChem CID 135982450) has the molecular formula C13H9ClN6O2S
and a molecular weight of 348.78 g/mol. Its IUPAC name is N-[3-chloro-2-hydroxy-5-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenyl]acetamide.
Molecular Properties
| Compound Name | N-[3-chloro-2-hydroxy-5-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenyl]acetamide |
| PubChem CID | 135982450 |
| Molecular Formula | C13H9ClN6O2S |
| Molecular Weight | 348.78 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | N-[3-chloro-2-hydroxy-5-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(/N=N/c2snc3ncncc23)cc(Cl)c1O |
| InChI | InChI=1S/C13H9ClN6O2S/c1-6(21)17-10-3-7(2-9(14)11(10)22)18-19-13-8-4-15-5-16-12(8)20-23-13/h2-5,22H,1H3,(H,17,21)/b19-18+ |
| InChIKey | VLVNFNKLFSXNPI-VHEBQXMUSA-N |
| XLogP | 3.82 |
| TPSA | 112.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.78 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[3-chloro-2-hydroxy-5-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-chloro-2-hydroxy-5-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenyl]acetamide?
The IUPAC name of N-[3-chloro-2-hydroxy-5-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenyl]acetamide (CID 135982450) is N-[3-chloro-2-hydroxy-5-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenyl]acetamide.
What is the SMILES notation for N-[3-chloro-2-hydroxy-5-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenyl]acetamide?
The canonical SMILES for N-[3-chloro-2-hydroxy-5-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenyl]acetamide is CC(=O)Nc1cc(/N=N/c2snc3ncncc23)cc(Cl)c1O.
What is the InChIKey of N-[3-chloro-2-hydroxy-5-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenyl]acetamide?
The InChIKey is VLVNFNKLFSXNPI-VHEBQXMUSA-N. The full InChI is InChI=1S/C13H9ClN6O2S/c1-6(21)17-10-3-7(2-9(14)11(10)22)18-19-13-8-4-15-5-16-12(8)20-23-13/h2-5,22H,1H3,(H,17,21)/b19-18+.
What are the key properties of N-[3-chloro-2-hydroxy-5-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenyl]acetamide?
N-[3-chloro-2-hydroxy-5-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenyl]acetamide has a molecular weight of 348.78 g/mol, XLogP of 3.82, 3 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-chloro-2-hydroxy-5-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenyl]acetamide is sourced from PubChem (CID 135982450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).