About N-[5-hydroxy-8-([1,2]thiazolo[3,4-b]pyrazin-3-yldiazenyl)naphthalen-1-yl]methanesulfonamide
N-[5-hydroxy-8-([1,2]thiazolo[3,4-b]pyrazin-3-yldiazenyl)naphthalen-1-yl]methanesulfonamide (PubChem CID 135982467) has the molecular formula C16H12N6O3S2
and a molecular weight of 400.45 g/mol. Its IUPAC name is N-[5-hydroxy-8-([1,2]thiazolo[3,4-b]pyrazin-3-yldiazenyl)naphthalen-1-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[5-hydroxy-8-([1,2]thiazolo[3,4-b]pyrazin-3-yldiazenyl)naphthalen-1-yl]methanesulfonamide |
| PubChem CID | 135982467 |
| Molecular Formula | C16H12N6O3S2 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | N-[5-hydroxy-8-([1,2]thiazolo[3,4-b]pyrazin-3-yldiazenyl)naphthalen-1-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc2c(O)ccc(/N=N/c3snc4nccnc34)c12 |
| InChI | InChI=1S/C16H12N6O3S2/c1-27(24,25)22-11-4-2-3-9-12(23)6-5-10(13(9)11)19-20-16-14-15(21-26-16)18-8-7-17-14/h2-8,22-23H,1H3/b20-19+ |
| InChIKey | GKNGPAHUIIVKPM-FMQUCBEESA-N |
| XLogP | 3.73 |
| TPSA | 129.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[5-hydroxy-8-([1,2]thiazolo[3,4-b]pyrazin-3-yldiazenyl)naphthalen-1-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-hydroxy-8-([1,2]thiazolo[3,4-b]pyrazin-3-yldiazenyl)naphthalen-1-yl]methanesulfonamide?
The IUPAC name of N-[5-hydroxy-8-([1,2]thiazolo[3,4-b]pyrazin-3-yldiazenyl)naphthalen-1-yl]methanesulfonamide (CID 135982467) is N-[5-hydroxy-8-([1,2]thiazolo[3,4-b]pyrazin-3-yldiazenyl)naphthalen-1-yl]methanesulfonamide.
What is the SMILES notation for N-[5-hydroxy-8-([1,2]thiazolo[3,4-b]pyrazin-3-yldiazenyl)naphthalen-1-yl]methanesulfonamide?
The canonical SMILES for N-[5-hydroxy-8-([1,2]thiazolo[3,4-b]pyrazin-3-yldiazenyl)naphthalen-1-yl]methanesulfonamide is CS(=O)(=O)Nc1cccc2c(O)ccc(/N=N/c3snc4nccnc34)c12.
What is the InChIKey of N-[5-hydroxy-8-([1,2]thiazolo[3,4-b]pyrazin-3-yldiazenyl)naphthalen-1-yl]methanesulfonamide?
The InChIKey is GKNGPAHUIIVKPM-FMQUCBEESA-N. The full InChI is InChI=1S/C16H12N6O3S2/c1-27(24,25)22-11-4-2-3-9-12(23)6-5-10(13(9)11)19-20-16-14-15(21-26-16)18-8-7-17-14/h2-8,22-23H,1H3/b20-19+.
What are the key properties of N-[5-hydroxy-8-([1,2]thiazolo[3,4-b]pyrazin-3-yldiazenyl)naphthalen-1-yl]methanesulfonamide?
N-[5-hydroxy-8-([1,2]thiazolo[3,4-b]pyrazin-3-yldiazenyl)naphthalen-1-yl]methanesulfonamide has a molecular weight of 400.45 g/mol, XLogP of 3.73, 4 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-hydroxy-8-([1,2]thiazolo[3,4-b]pyrazin-3-yldiazenyl)naphthalen-1-yl]methanesulfonamide is sourced from PubChem (CID 135982467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).