About 2,6-difluoro-4-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenol
2,6-difluoro-4-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenol (PubChem CID 135982472) has the molecular formula C11H5F2N5OS
and a molecular weight of 293.26 g/mol. Its IUPAC name is 2,6-difluoro-4-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenol.
Molecular Properties
| Compound Name | 2,6-difluoro-4-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenol |
| PubChem CID | 135982472 |
| Molecular Formula | C11H5F2N5OS |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 2,6-difluoro-4-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenol |
| SMILES | Oc1c(F)cc(/N=N/c2snc3ncncc23)cc1F |
| InChI | InChI=1S/C11H5F2N5OS/c12-7-1-5(2-8(13)9(7)19)16-17-11-6-3-14-4-15-10(6)18-20-11/h1-4,19H/b17-16+ |
| InChIKey | JHIFCAYSOHWRCK-WUKNDPDISA-N |
| XLogP | 3.49 |
| TPSA | 83.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2,6-difluoro-4-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-difluoro-4-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenol?
The IUPAC name of 2,6-difluoro-4-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenol (CID 135982472) is 2,6-difluoro-4-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenol.
What is the SMILES notation for 2,6-difluoro-4-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenol?
The canonical SMILES for 2,6-difluoro-4-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenol is Oc1c(F)cc(/N=N/c2snc3ncncc23)cc1F.
What is the InChIKey of 2,6-difluoro-4-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenol?
The InChIKey is JHIFCAYSOHWRCK-WUKNDPDISA-N. The full InChI is InChI=1S/C11H5F2N5OS/c12-7-1-5(2-8(13)9(7)19)16-17-11-6-3-14-4-15-10(6)18-20-11/h1-4,19H/b17-16+.
What are the key properties of 2,6-difluoro-4-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenol?
2,6-difluoro-4-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenol has a molecular weight of 293.26 g/mol, XLogP of 3.49, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-difluoro-4-([1,2]thiazolo[3,4-d]pyrimidin-3-yldiazenyl)phenol is sourced from PubChem (CID 135982472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).