C20H20N8O4 — CID 135983810
5-[5-[(5-amino-3-tert-butyl-1-methylpyrazol-4-yl)diazenyl]-4-isocyanopyrazol-1-yl]benzene-1,3-dicarboxylic acid (PubChem CID 135983810) has the molecular formula C20H20N8O4 and a molecular weight of 436.43 g/mol. Its IUPAC name is 5-[5-[(5-amino-3-tert-butyl-1-methylpyrazol-4-yl)diazenyl]-4-isocyanopyrazol-1-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[5-[(5-amino-3-tert-butyl-1-methylpyrazol-4-yl)diazenyl]-4-isocyanopyrazol-1-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 135983810 |
| Molecular Formula | C20H20N8O4 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 5-[5-[(5-amino-3-tert-butyl-1-methylpyrazol-4-yl)diazenyl]-4-isocyanopyrazol-1-yl]benzene-1,3-dicarboxylic acid |
| SMILES | [C-]#[N+]c1cnn(-c2cc(C(=O)O)cc(C(=O)O)c2)c1/N=N/c1c(C(C)(C)C)nn(C)c1N |
| InChI | InChI=1S/C20H20N8O4/c1-20(2,3)15-14(16(21)27(5)26-15)24-25-17-13(22-4)9-23-28(17)12-7-10(18(29)30)6-11(8-12)19(31)32/h6-9H,21H2,1-3,5H3,(H,29,30)(H,31,32)/b25-24+ |
| InChIKey | KFSCBYRZIXUBFR-OCOZRVBESA-N |
| XLogP | 3.85 |
| TPSA | 165.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|