C20H23N9O2 — CID 135983872
ethyl 5-[(6-tert-butyl-2-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-7-yl)diazenyl]-1-pyridin-2-ylpyrazole-4-carboxylate (PubChem CID 135983872) has the molecular formula C20H23N9O2 and a molecular weight of 421.47 g/mol. Its IUPAC name is ethyl 5-[(6-tert-butyl-2-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-7-yl)diazenyl]-1-pyridin-2-ylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(6-tert-butyl-2-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-7-yl)diazenyl]-1-pyridin-2-ylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 135983872 |
| Molecular Formula | C20H23N9O2 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | ethyl 5-[(6-tert-butyl-2-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-7-yl)diazenyl]-1-pyridin-2-ylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccccn2)c1/N=N/c1c(C(C)(C)C)[nH]n2nc(C)nc12 |
| InChI | InChI=1S/C20H23N9O2/c1-6-31-19(30)13-11-22-28(14-9-7-8-10-21-14)17(13)25-24-15-16(20(3,4)5)27-29-18(15)23-12(2)26-29/h7-11,27H,6H2,1-5H3/b25-24+ |
| InChIKey | JPHCXYOKCSHCHW-OCOZRVBESA-N |
| XLogP | 3.84 |
| TPSA | 127.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|