C19H26N6O — CID 135983934
4-tert-butyl-2-[(6-tert-butyl-2-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-7-yl)diazenyl]phenol (PubChem CID 135983934) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is 4-tert-butyl-2-[(6-tert-butyl-2-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-7-yl)diazenyl]phenol.
| Compound Name | 4-tert-butyl-2-[(6-tert-butyl-2-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-7-yl)diazenyl]phenol |
|---|---|
| PubChem CID | 135983934 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 4-tert-butyl-2-[(6-tert-butyl-2-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-7-yl)diazenyl]phenol |
| SMILES | Cc1nc2c(/N=N/c3cc(C(C)(C)C)ccc3O)c(C(C)(C)C)[nH]n2n1 |
| InChI | InChI=1S/C19H26N6O/c1-11-20-17-15(16(19(5,6)7)24-25(17)23-11)22-21-13-10-12(18(2,3)4)8-9-14(13)26/h8-10,24,26H,1-7H3/b22-21+ |
| InChIKey | ZXWFIXKNLHHMLK-QURGRASLSA-N |
| XLogP | 5.08 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|