C25H27N7O3 — CID 135983984
6-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-3H-quinazolin-4-one (PubChem CID 135983984) has the molecular formula C25H27N7O3 and a molecular weight of 473.54 g/mol. Its IUPAC name is 6-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-3H-quinazolin-4-one.
| Compound Name | 6-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135983984 |
| Molecular Formula | C25H27N7O3 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 6-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-3H-quinazolin-4-one |
| SMILES | C[C@H]1COCCN1c1nc(N2CCOC[C@@H]2C)c2ccc(-c3ccc4nc[nH]c(=O)c4c3)nc2n1 |
| InChI | InChI=1S/C25H27N7O3/c1-15-12-34-9-7-31(15)23-18-4-6-20(17-3-5-21-19(11-17)24(33)27-14-26-21)28-22(18)29-25(30-23)32-8-10-35-13-16(32)2/h3-6,11,14-16H,7-10,12-13H2,1-2H3,(H,26,27,33)/t15-,16-/m0/s1 |
| InChIKey | CTXQZZJRHXYZQA-HOTGVXAUSA-N |
| XLogP | 2.38 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |