C43H31N5O3 — CID 135985043
4-[10,20-bis(4-hydroxyphenyl)-15-pyridin-4-yl-21,22,23,24-tetrahydroporphyrin-5-yl]phenol (PubChem CID 135985043) has the molecular formula C43H31N5O3 and a molecular weight of 665.75 g/mol. Its IUPAC name is 4-[10,20-bis(4-hydroxyphenyl)-15-pyridin-4-yl-21,22,23,24-tetrahydroporphyrin-5-yl]phenol.
| Compound Name | 4-[10,20-bis(4-hydroxyphenyl)-15-pyridin-4-yl-21,22,23,24-tetrahydroporphyrin-5-yl]phenol |
|---|---|
| PubChem CID | 135985043 |
| Molecular Formula | C43H31N5O3 |
| Molecular Weight | 665.75 g/mol |
| Exact Mass | 665.24 |
| IUPAC Name | 4-[10,20-bis(4-hydroxyphenyl)-15-pyridin-4-yl-21,22,23,24-tetrahydroporphyrin-5-yl]phenol |
| SMILES | Oc1ccc(C2=c3ccc([nH]3)=C(c3ccncc3)c3ccc([nH]3)C(c3ccc(O)cc3)=c3ccc([nH]3)=C(c3ccc(O)cc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C43H31N5O3/c49-29-7-1-25(2-8-29)40-32-13-15-34(45-32)41(26-3-9-30(50)10-4-26)36-17-19-38(47-36)43(28-21-23-44-24-22-28)39-20-18-37(48-39)42(35-16-14-33(40)46-35)27-5-11-31(51)12-6-27/h1-24,45-51H |
| InChIKey | YUNZYYGYVUCOKR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 136.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.75 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 4 |