About sodium methyl (5E)-4-hydroxy-2-methyl-5-(phenylmethylidene)pyrrole-3-carboxylate
sodium methyl (5E)-4-hydroxy-2-methyl-5-(phenylmethylidene)pyrrole-3-carboxylate (PubChem CID 135985426) has the molecular formula C14H12NNaO3
and a molecular weight of 265.24 g/mol. Its IUPAC name is sodium methyl (5E)-4-hydroxy-2-methyl-5-(phenylmethylidene)pyrrole-3-carboxylate.
Molecular Properties
| Compound Name | sodium methyl (5E)-4-hydroxy-2-methyl-5-(phenylmethylidene)pyrrole-3-carboxylate |
| PubChem CID | 135985426 |
| Molecular Formula | C14H12NNaO3 |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | sodium methyl (5E)-4-hydroxy-2-methyl-5-(phenylmethylidene)pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(O)/C(=C\c2cc[c-]cc2)N=C1C.[Na+] |
| InChI | InChI=1S/C14H12NO3.Na/c1-9-12(14(17)18-2)13(16)11(15-9)8-10-6-4-3-5-7-10;/h4-8,16H,1-2H3;/q-1;+1/b11-8+; |
| InChIKey | AQADGYJXWBWOPC-YGCVIUNWSA-N |
| XLogP | -0.71 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium methyl (5E)-4-hydroxy-2-methyl-5-(phenylmethylidene)pyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium methyl (5E)-4-hydroxy-2-methyl-5-(phenylmethylidene)pyrrole-3-carboxylate?
The IUPAC name of sodium methyl (5E)-4-hydroxy-2-methyl-5-(phenylmethylidene)pyrrole-3-carboxylate (CID 135985426) is sodium methyl (5E)-4-hydroxy-2-methyl-5-(phenylmethylidene)pyrrole-3-carboxylate.
What is the SMILES notation for sodium methyl (5E)-4-hydroxy-2-methyl-5-(phenylmethylidene)pyrrole-3-carboxylate?
The canonical SMILES for sodium methyl (5E)-4-hydroxy-2-methyl-5-(phenylmethylidene)pyrrole-3-carboxylate is COC(=O)C1=C(O)/C(=C\c2cc[c-]cc2)N=C1C.[Na+].
What is the InChIKey of sodium methyl (5E)-4-hydroxy-2-methyl-5-(phenylmethylidene)pyrrole-3-carboxylate?
The InChIKey is AQADGYJXWBWOPC-YGCVIUNWSA-N. The full InChI is InChI=1S/C14H12NO3.Na/c1-9-12(14(17)18-2)13(16)11(15-9)8-10-6-4-3-5-7-10;/h4-8,16H,1-2H3;/q-1;+1/b11-8+;.
What are the key properties of sodium methyl (5E)-4-hydroxy-2-methyl-5-(phenylmethylidene)pyrrole-3-carboxylate?
sodium methyl (5E)-4-hydroxy-2-methyl-5-(phenylmethylidene)pyrrole-3-carboxylate has a molecular weight of 265.24 g/mol, XLogP of -0.71, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium methyl (5E)-4-hydroxy-2-methyl-5-(phenylmethylidene)pyrrole-3-carboxylate is sourced from PubChem (CID 135985426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).