About (E)-3-[1-[1-(1,3-benzoxazol-2-yl)-2-phenylethyl]triazol-4-yl]-N-hydroxyprop-2-enamide
(E)-3-[1-[1-(1,3-benzoxazol-2-yl)-2-phenylethyl]triazol-4-yl]-N-hydroxyprop-2-enamide (PubChem CID 135985866) has the molecular formula C20H17N5O3
and a molecular weight of 375.39 g/mol. Its IUPAC name is (E)-3-[1-[1-(1,3-benzoxazol-2-yl)-2-phenylethyl]triazol-4-yl]-N-hydroxyprop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-[1-[1-(1,3-benzoxazol-2-yl)-2-phenylethyl]triazol-4-yl]-N-hydroxyprop-2-enamide |
| PubChem CID | 135985866 |
| Molecular Formula | C20H17N5O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | (E)-3-[1-[1-(1,3-benzoxazol-2-yl)-2-phenylethyl]triazol-4-yl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1cn(C(Cc2ccccc2)c2nc3ccccc3o2)nn1)NO |
| InChI | InChI=1S/C20H17N5O3/c26-19(23-27)11-10-15-13-25(24-22-15)17(12-14-6-2-1-3-7-14)20-21-16-8-4-5-9-18(16)28-20/h1-11,13,17,27H,12H2,(H,23,26)/b11-10+ |
| InChIKey | RULRLQIJCMIWBP-ZHACJKMWSA-N |
| XLogP | 2.77 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[1-[1-(1,3-benzoxazol-2-yl)-2-phenylethyl]triazol-4-yl]-N-hydroxyprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[1-[1-(1,3-benzoxazol-2-yl)-2-phenylethyl]triazol-4-yl]-N-hydroxyprop-2-enamide?
The IUPAC name of (E)-3-[1-[1-(1,3-benzoxazol-2-yl)-2-phenylethyl]triazol-4-yl]-N-hydroxyprop-2-enamide (CID 135985866) is (E)-3-[1-[1-(1,3-benzoxazol-2-yl)-2-phenylethyl]triazol-4-yl]-N-hydroxyprop-2-enamide.
What is the SMILES notation for (E)-3-[1-[1-(1,3-benzoxazol-2-yl)-2-phenylethyl]triazol-4-yl]-N-hydroxyprop-2-enamide?
The canonical SMILES for (E)-3-[1-[1-(1,3-benzoxazol-2-yl)-2-phenylethyl]triazol-4-yl]-N-hydroxyprop-2-enamide is O=C(/C=C/c1cn(C(Cc2ccccc2)c2nc3ccccc3o2)nn1)NO.
What is the InChIKey of (E)-3-[1-[1-(1,3-benzoxazol-2-yl)-2-phenylethyl]triazol-4-yl]-N-hydroxyprop-2-enamide?
The InChIKey is RULRLQIJCMIWBP-ZHACJKMWSA-N. The full InChI is InChI=1S/C20H17N5O3/c26-19(23-27)11-10-15-13-25(24-22-15)17(12-14-6-2-1-3-7-14)20-21-16-8-4-5-9-18(16)28-20/h1-11,13,17,27H,12H2,(H,23,26)/b11-10+.
What are the key properties of (E)-3-[1-[1-(1,3-benzoxazol-2-yl)-2-phenylethyl]triazol-4-yl]-N-hydroxyprop-2-enamide?
(E)-3-[1-[1-(1,3-benzoxazol-2-yl)-2-phenylethyl]triazol-4-yl]-N-hydroxyprop-2-enamide has a molecular weight of 375.39 g/mol, XLogP of 2.77, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[1-[1-(1,3-benzoxazol-2-yl)-2-phenylethyl]triazol-4-yl]-N-hydroxyprop-2-enamide is sourced from PubChem (CID 135985866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).