C10H13N5O3S — CID 135986058
2-amino-9-[(2R,4S,5S)-4-hydroxy-5-(sulfanylmethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 135986058) has the molecular formula C10H13N5O3S and a molecular weight of 283.31 g/mol. Its IUPAC name is 2-amino-9-[(2R,4S,5S)-4-hydroxy-5-(sulfanylmethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,4S,5S)-4-hydroxy-5-(sulfanylmethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135986058 |
| Molecular Formula | C10H13N5O3S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 2-amino-9-[(2R,4S,5S)-4-hydroxy-5-(sulfanylmethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@H]2C[C@H](O)[C@@H](CS)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H13N5O3S/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(16)5(2-19)18-6/h3-6,16,19H,1-2H2,(H3,11,13,14,17)/t4-,5+,6+/m0/s1 |
| InChIKey | ZURJJTHJSVOFOO-KVQBGUIXSA-N |
| XLogP | -0.72 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|