C16H16ClFN2O3 — CID 135987214
ethyl 4-[2-(4-chloro-3-fluorophenyl)-6-oxo-1H-pyrimidin-4-yl]butanoate (PubChem CID 135987214) has the molecular formula C16H16ClFN2O3 and a molecular weight of 338.77 g/mol. Its IUPAC name is ethyl 4-[2-(4-chloro-3-fluorophenyl)-6-oxo-1H-pyrimidin-4-yl]butanoate.
| Compound Name | ethyl 4-[2-(4-chloro-3-fluorophenyl)-6-oxo-1H-pyrimidin-4-yl]butanoate |
|---|---|
| PubChem CID | 135987214 |
| Molecular Formula | C16H16ClFN2O3 |
| Molecular Weight | 338.77 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | ethyl 4-[2-(4-chloro-3-fluorophenyl)-6-oxo-1H-pyrimidin-4-yl]butanoate |
| SMILES | CCOC(=O)CCCc1cc(=O)[nH]c(-c2ccc(Cl)c(F)c2)n1 |
| InChI | InChI=1S/C16H16ClFN2O3/c1-2-23-15(22)5-3-4-11-9-14(21)20-16(19-11)10-6-7-12(17)13(18)8-10/h6-9H,2-5H2,1H3,(H,19,20,21) |
| InChIKey | RNDXAQMOBUUHGI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.77 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |