C14H8Cl2N4O3 — CID 135987649
2,4-dichloro-6-[3-(4-nitrophenyl)-1H-1,2,4-triazol-5-yl]phenol (PubChem CID 135987649) has the molecular formula C14H8Cl2N4O3 and a molecular weight of 351.15 g/mol. Its IUPAC name is 2,4-dichloro-6-[3-(4-nitrophenyl)-1H-1,2,4-triazol-5-yl]phenol.
| Compound Name | 2,4-dichloro-6-[3-(4-nitrophenyl)-1H-1,2,4-triazol-5-yl]phenol |
|---|---|
| PubChem CID | 135987649 |
| Molecular Formula | C14H8Cl2N4O3 |
| Molecular Weight | 351.15 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 2,4-dichloro-6-[3-(4-nitrophenyl)-1H-1,2,4-triazol-5-yl]phenol |
| SMILES | O=[N+]([O-])c1ccc(-c2n[nH]c(-c3cc(Cl)cc(Cl)c3O)n2)cc1 |
| InChI | InChI=1S/C14H8Cl2N4O3/c15-8-5-10(12(21)11(16)6-8)14-17-13(18-19-14)7-1-3-9(4-2-7)20(22)23/h1-6,21H,(H,17,18,19) |
| InChIKey | LHTRROGMCFADRK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.15 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|