C14H7Cl2N5O5 — CID 135987667
2-[3-(3,4-dichlorophenyl)-1H-1,2,4-triazol-5-yl]-4,6-dinitrophenol (PubChem CID 135987667) has the molecular formula C14H7Cl2N5O5 and a molecular weight of 396.15 g/mol. Its IUPAC name is 2-[3-(3,4-dichlorophenyl)-1H-1,2,4-triazol-5-yl]-4,6-dinitrophenol.
| Compound Name | 2-[3-(3,4-dichlorophenyl)-1H-1,2,4-triazol-5-yl]-4,6-dinitrophenol |
|---|---|
| PubChem CID | 135987667 |
| Molecular Formula | C14H7Cl2N5O5 |
| Molecular Weight | 396.15 g/mol |
| Exact Mass | 394.98 |
| IUPAC Name | 2-[3-(3,4-dichlorophenyl)-1H-1,2,4-triazol-5-yl]-4,6-dinitrophenol |
| SMILES | O=[N+]([O-])c1cc(-c2nc(-c3ccc(Cl)c(Cl)c3)n[nH]2)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H7Cl2N5O5/c15-9-2-1-6(3-10(9)16)13-17-14(19-18-13)8-4-7(20(23)24)5-11(12(8)22)21(25)26/h1-5,22H,(H,17,18,19) |
| InChIKey | XRQAMQGBTZBNHX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 148.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.15 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|