C27H27N3O — CID 135987672
2-methyl-4-[4-phenyl-6-[propyl(pyridin-2-ylmethyl)amino]-2-pyridinyl]phenol (PubChem CID 135987672) has the molecular formula C27H27N3O and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-methyl-4-[4-phenyl-6-[propyl(pyridin-2-ylmethyl)amino]-2-pyridinyl]phenol.
| Compound Name | 2-methyl-4-[4-phenyl-6-[propyl(pyridin-2-ylmethyl)amino]-2-pyridinyl]phenol |
|---|---|
| PubChem CID | 135987672 |
| Molecular Formula | C27H27N3O |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 2-methyl-4-[4-phenyl-6-[propyl(pyridin-2-ylmethyl)amino]-2-pyridinyl]phenol |
| SMILES | CCCN(Cc1ccccn1)c1cc(-c2ccccc2)cc(-c2ccc(O)c(C)c2)n1 |
| InChI | InChI=1S/C27H27N3O/c1-3-15-30(19-24-11-7-8-14-28-24)27-18-23(21-9-5-4-6-10-21)17-25(29-27)22-12-13-26(31)20(2)16-22/h4-14,16-18,31H,3,15,19H2,1-2H3 |
| InChIKey | RRNFUZMGIKMXIE-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |