C19H19BrN4O3S — CID 135987751
N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide (PubChem CID 135987751) has the molecular formula C19H19BrN4O3S and a molecular weight of 463.36 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 135987751 |
| Molecular Formula | C19H19BrN4O3S |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide |
| SMILES | CCn1c(SCC(=O)N/N=C\c2cc(Br)c(O)c(OC)c2)nc2ccccc21 |
| InChI | InChI=1S/C19H19BrN4O3S/c1-3-24-15-7-5-4-6-14(15)22-19(24)28-11-17(25)23-21-10-12-8-13(20)18(26)16(9-12)27-2/h4-10,26H,3,11H2,1-2H3,(H,23,25)/b21-10- |
| InChIKey | ACMZZCAAFKBLSH-FBHDLOMBSA-N |
| XLogP | 3.78 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|