About 3-propan-2-ylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one
3-propan-2-ylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 135988205) has the molecular formula C5H9N3OS
and a molecular weight of 159.21 g/mol. Its IUPAC name is 3-propan-2-ylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one.
Analyze 3-propan-2-ylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-ylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one?
The IUPAC name of 3-propan-2-ylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one (CID 135988205) is 3-propan-2-ylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one.
What is the SMILES notation for 3-propan-2-ylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one?
The canonical SMILES for 3-propan-2-ylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one is CC(C)Sc1n[nH]c(=O)[nH]1.
What is the InChIKey of 3-propan-2-ylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one?
The InChIKey is HIMRAOOMAFSYKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3OS/c1-3(2)10-5-6-4(9)7-8-5/h3H,1-2H3,(H2,6,7,8,9).
What are the key properties of 3-propan-2-ylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one?
3-propan-2-ylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one has a molecular weight of 159.21 g/mol, XLogP of 0.60, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-ylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one is sourced from PubChem (CID 135988205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).