C15H11N3O — CID 135988232
14-methyl-12,13,17-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,11,14-heptaen-16-one (PubChem CID 135988232) has the molecular formula C15H11N3O and a molecular weight of 249.27 g/mol. Its IUPAC name is 14-methyl-12,13,17-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,11,14-heptaen-16-one.
| Compound Name | 14-methyl-12,13,17-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,11,14-heptaen-16-one |
|---|---|
| PubChem CID | 135988232 |
| Molecular Formula | C15H11N3O |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 14-methyl-12,13,17-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,11,14-heptaen-16-one |
| SMILES | Cc1[nH]nc2c1c(=O)[nH]c1cc3ccccc3cc12 |
| InChI | InChI=1S/C15H11N3O/c1-8-13-14(18-17-8)11-6-9-4-2-3-5-10(9)7-12(11)16-15(13)19/h2-7H,1H3,(H,16,19)(H,17,18) |
| InChIKey | URVQYHFWSXVWGH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|