C20H13F4N5O6 — CID 135988458
(2,5-dihydroxypyrrol-1-yl) (2S)-2-[(4-azido-2,3,5,6-tetrafluorobenzoyl)amino]-3-(4-hydroxyphenyl)propanoate (PubChem CID 135988458) has the molecular formula C20H13F4N5O6 and a molecular weight of 495.35 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) (2S)-2-[(4-azido-2,3,5,6-tetrafluorobenzoyl)amino]-3-(4-hydroxyphenyl)propanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) (2S)-2-[(4-azido-2,3,5,6-tetrafluorobenzoyl)amino]-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 135988458 |
| Molecular Formula | C20H13F4N5O6 |
| Molecular Weight | 495.35 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) (2S)-2-[(4-azido-2,3,5,6-tetrafluorobenzoyl)amino]-3-(4-hydroxyphenyl)propanoate |
| SMILES | [N-]=[N+]=Nc1c(F)c(F)c(C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)On2c(O)ccc2O)c(F)c1F |
| InChI | InChI=1S/C20H13F4N5O6/c21-14-13(15(22)17(24)18(16(14)23)27-28-25)19(33)26-10(7-8-1-3-9(30)4-2-8)20(34)35-29-11(31)5-6-12(29)32/h1-6,10,30-32H,7H2,(H,26,33)/t10-/m0/s1 |
| InChIKey | LVKYKUCPTBTAPD-JTQLQIEISA-N |
| XLogP | 3.10 |
| TPSA | 169.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|