C14H17F3N4O3 — CID 135988585
1-(5,5-difluoropentyl)-6-(1-fluoroethyl)-3-methyl-7H-pyrimido[5,4-d]pyrimidine-2,4,8-trione (PubChem CID 135988585) has the molecular formula C14H17F3N4O3 and a molecular weight of 346.31 g/mol. Its IUPAC name is 1-(5,5-difluoropentyl)-6-(1-fluoroethyl)-3-methyl-7H-pyrimido[5,4-d]pyrimidine-2,4,8-trione.
| Compound Name | 1-(5,5-difluoropentyl)-6-(1-fluoroethyl)-3-methyl-7H-pyrimido[5,4-d]pyrimidine-2,4,8-trione |
|---|---|
| PubChem CID | 135988585 |
| Molecular Formula | C14H17F3N4O3 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 1-(5,5-difluoropentyl)-6-(1-fluoroethyl)-3-methyl-7H-pyrimido[5,4-d]pyrimidine-2,4,8-trione |
| SMILES | CC(F)c1nc2c(=O)n(C)c(=O)n(CCCCC(F)F)c2c(=O)[nH]1 |
| InChI | InChI=1S/C14H17F3N4O3/c1-7(15)11-18-9-10(12(22)19-11)21(6-4-3-5-8(16)17)14(24)20(2)13(9)23/h7-8H,3-6H2,1-2H3,(H,18,19,22) |
| InChIKey | RATBNWQPHMHAGH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|