C14H19FN4O3 — CID 135988586
6-(1-fluoroethyl)-3-methyl-1-pentyl-7H-pyrimido[5,4-d]pyrimidine-2,4,8-trione (PubChem CID 135988586) has the molecular formula C14H19FN4O3 and a molecular weight of 310.33 g/mol. Its IUPAC name is 6-(1-fluoroethyl)-3-methyl-1-pentyl-7H-pyrimido[5,4-d]pyrimidine-2,4,8-trione.
| Compound Name | 6-(1-fluoroethyl)-3-methyl-1-pentyl-7H-pyrimido[5,4-d]pyrimidine-2,4,8-trione |
|---|---|
| PubChem CID | 135988586 |
| Molecular Formula | C14H19FN4O3 |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 6-(1-fluoroethyl)-3-methyl-1-pentyl-7H-pyrimido[5,4-d]pyrimidine-2,4,8-trione |
| SMILES | CCCCCn1c(=O)n(C)c(=O)c2nc(C(C)F)[nH]c(=O)c21 |
| InChI | InChI=1S/C14H19FN4O3/c1-4-5-6-7-19-10-9(13(21)18(3)14(19)22)16-11(8(2)15)17-12(10)20/h8H,4-7H2,1-3H3,(H,16,17,20) |
| InChIKey | YJJQIZDNGGYQJH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|