C42H28N6O4S2 — CID 135988622
methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-bis(1,3-thiazol-2-yl)-21,23-dihydroporphyrin-5-yl]benzoate (PubChem CID 135988622) has the molecular formula C42H28N6O4S2 and a molecular weight of 744.86 g/mol. Its IUPAC name is methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-bis(1,3-thiazol-2-yl)-21,23-dihydroporphyrin-5-yl]benzoate.
| Compound Name | methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-bis(1,3-thiazol-2-yl)-21,23-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 135988622 |
| Molecular Formula | C42H28N6O4S2 |
| Molecular Weight | 744.86 g/mol |
| Exact Mass | 744.16 |
| IUPAC Name | methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-bis(1,3-thiazol-2-yl)-21,23-dihydroporphyrin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2c3nc(c(-c4nccs4)c4ccc([nH]4)c(-c4ccc(C(=O)OC)cc4)c4nc(c(-c5nccs5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C42H28N6O4S2/c1-51-41(49)25-7-3-23(4-8-25)35-27-11-15-31(45-27)37(39-43-19-21-53-39)33-17-13-29(47-33)36(24-5-9-26(10-6-24)42(50)52-2)30-14-18-34(48-30)38(40-44-20-22-54-40)32-16-12-28(35)46-32/h3-22,45,48H,1-2H3/b35-27-,35-28-,36-29-,36-30-,37-31+,37-33+,38-32+,38-34+ |
| InChIKey | LDJNXGSKKVQFMO-SDCNOMAISA-N |
| XLogP | 9.81 |
| TPSA | 135.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.86 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |