C14H19F3N2O2S — CID 135989355
2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-methyl-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-1,3-thiazolidin-4-one (PubChem CID 135989355) has the molecular formula C14H19F3N2O2S and a molecular weight of 336.38 g/mol. Its IUPAC name is 2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-methyl-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-1,3-thiazolidin-4-one.
| Compound Name | 2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-methyl-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135989355 |
| Molecular Formula | C14H19F3N2O2S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-methyl-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-1,3-thiazolidin-4-one |
| SMILES | CC1(C(C)(O)C(F)(F)F)S/C(=N/[C@H]2C[C@@H]3CC[C@H]2C3)NC1=O |
| InChI | InChI=1S/C14H19F3N2O2S/c1-12(13(2,21)14(15,16)17)10(20)19-11(22-12)18-9-6-7-3-4-8(9)5-7/h7-9,21H,3-6H2,1-2H3,(H,18,19,20)/t7-,8+,9+,12?,13?/m1/s1 |
| InChIKey | QFMUCEVGSZEFIN-GDRHZDGNSA-N |
| XLogP | 2.47 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|