C17H15F2N3OS — CID 135989416
(5R)-2-[(1S)-1-(2,4-difluorophenyl)ethyl]imino-5-methyl-5-pyridin-4-yl-1,3-thiazolidin-4-one (PubChem CID 135989416) has the molecular formula C17H15F2N3OS and a molecular weight of 347.39 g/mol. Its IUPAC name is (5R)-2-[(1S)-1-(2,4-difluorophenyl)ethyl]imino-5-methyl-5-pyridin-4-yl-1,3-thiazolidin-4-one.
| Compound Name | (5R)-2-[(1S)-1-(2,4-difluorophenyl)ethyl]imino-5-methyl-5-pyridin-4-yl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135989416 |
| Molecular Formula | C17H15F2N3OS |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | (5R)-2-[(1S)-1-(2,4-difluorophenyl)ethyl]imino-5-methyl-5-pyridin-4-yl-1,3-thiazolidin-4-one |
| SMILES | C[C@H](/N=C1\NC(=O)[C@@](C)(c2ccncc2)S1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H15F2N3OS/c1-10(13-4-3-12(18)9-14(13)19)21-16-22-15(23)17(2,24-16)11-5-7-20-8-6-11/h3-10H,1-2H3,(H,21,22,23)/t10-,17+/m0/s1 |
| InChIKey | OVOQHAJUCIBYSU-DYZYQPBXSA-N |
| XLogP | 3.56 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|