About 2-[(2R)-3,3-dimethylbutan-2-yl]imino-5-propan-2-yl-1,3-thiazolidin-4-one
2-[(2R)-3,3-dimethylbutan-2-yl]imino-5-propan-2-yl-1,3-thiazolidin-4-one (PubChem CID 135989878) has the molecular formula C12H22N2OS
and a molecular weight of 242.39 g/mol. Its IUPAC name is 2-[(2R)-3,3-dimethylbutan-2-yl]imino-5-propan-2-yl-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 2-[(2R)-3,3-dimethylbutan-2-yl]imino-5-propan-2-yl-1,3-thiazolidin-4-one |
| PubChem CID | 135989878 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 2-[(2R)-3,3-dimethylbutan-2-yl]imino-5-propan-2-yl-1,3-thiazolidin-4-one |
| SMILES | CC(C)C1S/C(=N\[C@H](C)C(C)(C)C)NC1=O |
| InChI | InChI=1S/C12H22N2OS/c1-7(2)9-10(15)14-11(16-9)13-8(3)12(4,5)6/h7-9H,1-6H3,(H,13,14,15)/t8-,9?/m1/s1 |
| InChIKey | RJQDZJYTXDFKMY-VEDVMXKPSA-N |
| XLogP | 2.66 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2R)-3,3-dimethylbutan-2-yl]imino-5-propan-2-yl-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R)-3,3-dimethylbutan-2-yl]imino-5-propan-2-yl-1,3-thiazolidin-4-one?
The IUPAC name of 2-[(2R)-3,3-dimethylbutan-2-yl]imino-5-propan-2-yl-1,3-thiazolidin-4-one (CID 135989878) is 2-[(2R)-3,3-dimethylbutan-2-yl]imino-5-propan-2-yl-1,3-thiazolidin-4-one.
What is the SMILES notation for 2-[(2R)-3,3-dimethylbutan-2-yl]imino-5-propan-2-yl-1,3-thiazolidin-4-one?
The canonical SMILES for 2-[(2R)-3,3-dimethylbutan-2-yl]imino-5-propan-2-yl-1,3-thiazolidin-4-one is CC(C)C1S/C(=N\[C@H](C)C(C)(C)C)NC1=O.
What is the InChIKey of 2-[(2R)-3,3-dimethylbutan-2-yl]imino-5-propan-2-yl-1,3-thiazolidin-4-one?
The InChIKey is RJQDZJYTXDFKMY-VEDVMXKPSA-N. The full InChI is InChI=1S/C12H22N2OS/c1-7(2)9-10(15)14-11(16-9)13-8(3)12(4,5)6/h7-9H,1-6H3,(H,13,14,15)/t8-,9?/m1/s1.
What are the key properties of 2-[(2R)-3,3-dimethylbutan-2-yl]imino-5-propan-2-yl-1,3-thiazolidin-4-one?
2-[(2R)-3,3-dimethylbutan-2-yl]imino-5-propan-2-yl-1,3-thiazolidin-4-one has a molecular weight of 242.39 g/mol, XLogP of 2.66, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R)-3,3-dimethylbutan-2-yl]imino-5-propan-2-yl-1,3-thiazolidin-4-one is sourced from PubChem (CID 135989878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).