C20H18FN3O2 — CID 135990303
3-(3-fluorophenyl)-N-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)ethyl]benzamide (PubChem CID 135990303) has the molecular formula C20H18FN3O2 and a molecular weight of 351.38 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)ethyl]benzamide.
| Compound Name | 3-(3-fluorophenyl)-N-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 135990303 |
| Molecular Formula | C20H18FN3O2 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 3-(3-fluorophenyl)-N-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)ethyl]benzamide |
| SMILES | Cc1cc(=O)[nH]c(CCNC(=O)c2cccc(-c3cccc(F)c3)c2)n1 |
| InChI | InChI=1S/C20H18FN3O2/c1-13-10-19(25)24-18(23-13)8-9-22-20(26)16-6-2-4-14(11-16)15-5-3-7-17(21)12-15/h2-7,10-12H,8-9H2,1H3,(H,22,26)(H,23,24,25) |
| InChIKey | ZAQNNNUOVZHJOH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |