C10H10N2O3 — CID 135990622
3-(2,5-dihydroxyphenyl)-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 135990622) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is 3-(2,5-dihydroxyphenyl)-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 3-(2,5-dihydroxyphenyl)-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 135990622 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 3-(2,5-dihydroxyphenyl)-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | O=C1CCC(c2cc(O)ccc2O)=NN1 |
| InChI | InChI=1S/C10H10N2O3/c13-6-1-3-9(14)7(5-6)8-2-4-10(15)12-11-8/h1,3,5,13-14H,2,4H2,(H,12,15) |
| InChIKey | JANCHRFDAUDIEZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|